C19H12N2O3 — CID 11631073
3-amino-9-oxo-1-phenylindeno[2,1-c]pyridine-4-carboxylic acid (PubChem CID 11631073) has the molecular formula C19H12N2O3 and a molecular weight of 316.32 g/mol. Its IUPAC name is 3-amino-9-oxo-1-phenylindeno[2,1-c]pyridine-4-carboxylic acid.
| Compound Name | 3-amino-9-oxo-1-phenylindeno[2,1-c]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 11631073 |
| Molecular Formula | C19H12N2O3 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 3-amino-9-oxo-1-phenylindeno[2,1-c]pyridine-4-carboxylic acid |
| SMILES | Nc1nc(-c2ccccc2)c2c(c1C(=O)O)-c1ccccc1C2=O |
| InChI | InChI=1S/C19H12N2O3/c20-18-15(19(23)24)13-11-8-4-5-9-12(11)17(22)14(13)16(21-18)10-6-2-1-3-7-10/h1-9H,(H2,20,21)(H,23,24) |
| InChIKey | YQPIANBEGXLAIZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |