C21H15NO2 — CID 949215
3-acetyl-2-methyl-4-phenylindeno[1,2-b]pyridin-5-one (PubChem CID 949215) has the molecular formula C21H15NO2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-acetyl-2-methyl-4-phenylindeno[1,2-b]pyridin-5-one.
| Compound Name | 3-acetyl-2-methyl-4-phenylindeno[1,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 949215 |
| Molecular Formula | C21H15NO2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-acetyl-2-methyl-4-phenylindeno[1,2-b]pyridin-5-one |
| SMILES | CC(=O)c1c(C)nc2c(c1-c1ccccc1)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C21H15NO2/c1-12-17(13(2)23)18(14-8-4-3-5-9-14)19-20(22-12)15-10-6-7-11-16(15)21(19)24/h3-11H,1-2H3 |
| InChIKey | OTFPGRZRXLVTCV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|