C31H30N2O2S2 — CID 157425406
(2-amino-4,5-dimethylthiophen-3-yl)-phenylmethanone;1-(2,3,6-trimethyl-4-phenylthieno[2,3-b]pyridin-5-yl)ethanone (PubChem CID 157425406) has the molecular formula C31H30N2O2S2 and a molecular weight of 526.73 g/mol. Its IUPAC name is (2-amino-4,5-dimethylthiophen-3-yl)-phenylmethanone;1-(2,3,6-trimethyl-4-phenylthieno[2,3-b]pyridin-5-yl)ethanone.
| Compound Name | (2-amino-4,5-dimethylthiophen-3-yl)-phenylmethanone;1-(2,3,6-trimethyl-4-phenylthieno[2,3-b]pyridin-5-yl)ethanone |
|---|---|
| PubChem CID | 157425406 |
| Molecular Formula | C31H30N2O2S2 |
| Molecular Weight | 526.73 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | (2-amino-4,5-dimethylthiophen-3-yl)-phenylmethanone;1-(2,3,6-trimethyl-4-phenylthieno[2,3-b]pyridin-5-yl)ethanone |
| SMILES | CC(=O)c1c(C)nc2sc(C)c(C)c2c1-c1ccccc1.Cc1sc(N)c(C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C18H17NOS.C13H13NOS/c1-10-13(4)21-18-15(10)17(14-8-6-5-7-9-14)16(12(3)20)11(2)19-18;1-8-9(2)16-13(14)11(8)12(15)10-6-4-3-5-7-10/h5-9H,1-4H3;3-7H,14H2,1-2H3 |
| InChIKey | BPWZUXMLEFNVHQ-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.73 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|