C13H12ClNOS — CID 859637
(2-amino-4,5-dimethylthiophen-3-yl)-(2-chlorophenyl)methanone (PubChem CID 859637) has the molecular formula C13H12ClNOS and a molecular weight of 265.76 g/mol. Its IUPAC name is (2-amino-4,5-dimethylthiophen-3-yl)-(2-chlorophenyl)methanone.
| Compound Name | (2-amino-4,5-dimethylthiophen-3-yl)-(2-chlorophenyl)methanone |
|---|---|
| PubChem CID | 859637 |
| Molecular Formula | C13H12ClNOS |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | (2-amino-4,5-dimethylthiophen-3-yl)-(2-chlorophenyl)methanone |
| SMILES | Cc1sc(N)c(C(=O)c2ccccc2Cl)c1C |
| InChI | InChI=1S/C13H12ClNOS/c1-7-8(2)17-13(15)11(7)12(16)9-5-3-4-6-10(9)14/h3-6H,15H2,1-2H3 |
| InChIKey | LERBRJLVKFXYFJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|