C16H19NOS — CID 11011169
(2-amino-4,5-dimethylthiophen-3-yl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 11011169) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is (2-amino-4,5-dimethylthiophen-3-yl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (2-amino-4,5-dimethylthiophen-3-yl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 11011169 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (2-amino-4,5-dimethylthiophen-3-yl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2c(N)sc(C)c2C)c(C)c1 |
| InChI | InChI=1S/C16H19NOS/c1-8-6-9(2)13(10(3)7-8)15(18)14-11(4)12(5)19-16(14)17/h6-7H,17H2,1-5H3 |
| InChIKey | YRKXIAKWVDBKBQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'} |
|---|