C16H13Cl3O — CID 172843385
(2,3,6-trichlorophenyl)-(2,4,6-trimethylphenyl)methanone (PubChem CID 172843385) has the molecular formula C16H13Cl3O and a molecular weight of 327.64 g/mol. Its IUPAC name is (2,3,6-trichlorophenyl)-(2,4,6-trimethylphenyl)methanone.
| Compound Name | (2,3,6-trichlorophenyl)-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 172843385 |
| Molecular Formula | C16H13Cl3O |
| Molecular Weight | 327.64 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | (2,3,6-trichlorophenyl)-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2c(Cl)ccc(Cl)c2Cl)c(C)c1 |
| InChI | InChI=1S/C16H13Cl3O/c1-8-6-9(2)13(10(3)7-8)16(20)14-11(17)4-5-12(18)15(14)19/h4-7H,1-3H3 |
| InChIKey | XCDMGTSTFSPZPN-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.64 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|