C22H28N2O8S2 — CID 167693415
N-(1,3-dioxo-2-benzofuran-4-yl)acetamide;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine;sulfane (PubChem CID 167693415) has the molecular formula C22H28N2O8S2 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-(1,3-dioxo-2-benzofuran-4-yl)acetamide;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine;sulfane.
| Compound Name | N-(1,3-dioxo-2-benzofuran-4-yl)acetamide;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine;sulfane |
|---|---|
| PubChem CID | 167693415 |
| Molecular Formula | C22H28N2O8S2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | N-(1,3-dioxo-2-benzofuran-4-yl)acetamide;(1S)-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine;sulfane |
| SMILES | CC(=O)Nc1cccc2c1C(=O)OC2=O.CCOc1cc([C@H](N)CS(C)(=O)=O)ccc1OC.S |
| InChI | InChI=1S/C12H19NO4S.C10H7NO4.H2S/c1-4-17-12-7-9(5-6-11(12)16-2)10(13)8-18(3,14)15;1-5(12)11-7-4-2-3-6-8(7)10(14)15-9(6)13;/h5-7,10H,4,8,13H2,1-3H3;2-4H,1H3,(H,11,12);1H2/t10-;;/m1../s1 |
| InChIKey | XHDMEFOAEAONFE-YQFADDPSSA-N |
| XLogP | 2.21 |
| TPSA | 151.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|