C22H24N2O7S — CID 175007704
N-(1,3-dioxoisoindol-4-yl)-3-(3-ethoxy-4-methoxyphenyl)-4-methylsulfonylbutanamide (PubChem CID 175007704) has the molecular formula C22H24N2O7S and a molecular weight of 460.51 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-4-yl)-3-(3-ethoxy-4-methoxyphenyl)-4-methylsulfonylbutanamide.
| Compound Name | N-(1,3-dioxoisoindol-4-yl)-3-(3-ethoxy-4-methoxyphenyl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 175007704 |
| Molecular Formula | C22H24N2O7S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | N-(1,3-dioxoisoindol-4-yl)-3-(3-ethoxy-4-methoxyphenyl)-4-methylsulfonylbutanamide |
| SMILES | CCOc1cc(C(CC(=O)Nc2cccc3c2C(=O)NC3=O)CS(C)(=O)=O)ccc1OC |
| InChI | InChI=1S/C22H24N2O7S/c1-4-31-18-10-13(8-9-17(18)30-2)14(12-32(3,28)29)11-19(25)23-16-7-5-6-15-20(16)22(27)24-21(15)26/h5-10,14H,4,11-12H2,1-3H3,(H,23,25)(H,24,26,27) |
| InChIKey | RRWLZHSNHXCGKT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|