C25H34O9S2 — CID 154400068
2,4-bis(3-ethoxy-4-methoxyphenyl)-1,5-bis(methylsulfonyl)pentan-3-one (PubChem CID 154400068) has the molecular formula C25H34O9S2 and a molecular weight of 542.67 g/mol. Its IUPAC name is 2,4-bis(3-ethoxy-4-methoxyphenyl)-1,5-bis(methylsulfonyl)pentan-3-one.
| Compound Name | 2,4-bis(3-ethoxy-4-methoxyphenyl)-1,5-bis(methylsulfonyl)pentan-3-one |
|---|---|
| PubChem CID | 154400068 |
| Molecular Formula | C25H34O9S2 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 2,4-bis(3-ethoxy-4-methoxyphenyl)-1,5-bis(methylsulfonyl)pentan-3-one |
| SMILES | CCOc1cc(C(CS(C)(=O)=O)C(=O)C(CS(C)(=O)=O)c2ccc(OC)c(OCC)c2)ccc1OC |
| InChI | InChI=1S/C25H34O9S2/c1-7-33-23-13-17(9-11-21(23)31-3)19(15-35(5,27)28)25(26)20(16-36(6,29)30)18-10-12-22(32-4)24(14-18)34-8-2/h9-14,19-20H,7-8,15-16H2,1-6H3 |
| InChIKey | XZHDJRVXJYXARL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |