C12H19NO4S — CID 90049002
(1S)-1-deuterio-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine (PubChem CID 90049002) has the molecular formula C12H19NO4S and a molecular weight of 274.36 g/mol. Its IUPAC name is (1S)-1-deuterio-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine.
| Compound Name | (1S)-1-deuterio-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine |
|---|---|
| PubChem CID | 90049002 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (1S)-1-deuterio-1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethanamine |
| SMILES | [2H][C@@](N)(CS(C)(=O)=O)c1ccc(OC)c(OCC)c1 |
| InChI | InChI=1S/C12H19NO4S/c1-4-17-12-7-9(5-6-11(12)16-2)10(13)8-18(3,14)15/h5-7,10H,4,8,13H2,1-3H3/t10-/m1/s1/i10D |
| InChIKey | BXUJVINGXQGNFD-NOKLIFDOSA-N |
| XLogP | 1.14 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |