C19H13N3O5 — CID 3898701
N-[2-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-4-yl]acetamide (PubChem CID 3898701) has the molecular formula C19H13N3O5 and a molecular weight of 363.33 g/mol. Its IUPAC name is N-[2-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-4-yl]acetamide.
| Compound Name | N-[2-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 3898701 |
| Molecular Formula | C19H13N3O5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-[2-(2-methyl-1,3-dioxoisoindol-5-yl)-1,3-dioxoisoindol-4-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c1C(=O)N(c1ccc3c(c1)C(=O)N(C)C3=O)C2=O |
| InChI | InChI=1S/C19H13N3O5/c1-9(23)20-14-5-3-4-12-15(14)19(27)22(18(12)26)10-6-7-11-13(8-10)17(25)21(2)16(11)24/h3-8H,1-2H3,(H,20,23) |
| InChIKey | ORKWQHFLOYYXJN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|