C24H20N2O4 — CID 5028313
N-[2-[4-(3,4-dimethylphenoxy)phenyl]-1,3-dioxoisoindol-4-yl]acetamide (PubChem CID 5028313) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is N-[2-[4-(3,4-dimethylphenoxy)phenyl]-1,3-dioxoisoindol-4-yl]acetamide.
| Compound Name | N-[2-[4-(3,4-dimethylphenoxy)phenyl]-1,3-dioxoisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 5028313 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N-[2-[4-(3,4-dimethylphenoxy)phenyl]-1,3-dioxoisoindol-4-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c1C(=O)N(c1ccc(Oc3ccc(C)c(C)c3)cc1)C2=O |
| InChI | InChI=1S/C24H20N2O4/c1-14-7-10-19(13-15(14)2)30-18-11-8-17(9-12-18)26-23(28)20-5-4-6-21(25-16(3)27)22(20)24(26)29/h4-13H,1-3H3,(H,25,27) |
| InChIKey | KWLKFDHFYVMEFK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|