C16H10Cl2N2O3 — CID 23735335
2,5-dichloro-N-(2-methyl-1,3-dioxoisoindol-4-yl)benzamide (PubChem CID 23735335) has the molecular formula C16H10Cl2N2O3 and a molecular weight of 349.17 g/mol. Its IUPAC name is 2,5-dichloro-N-(2-methyl-1,3-dioxoisoindol-4-yl)benzamide.
| Compound Name | 2,5-dichloro-N-(2-methyl-1,3-dioxoisoindol-4-yl)benzamide |
|---|---|
| PubChem CID | 23735335 |
| Molecular Formula | C16H10Cl2N2O3 |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 2,5-dichloro-N-(2-methyl-1,3-dioxoisoindol-4-yl)benzamide |
| SMILES | CN1C(=O)c2cccc(NC(=O)c3cc(Cl)ccc3Cl)c2C1=O |
| InChI | InChI=1S/C16H10Cl2N2O3/c1-20-15(22)9-3-2-4-12(13(9)16(20)23)19-14(21)10-7-8(17)5-6-11(10)18/h2-7H,1H3,(H,19,21) |
| InChIKey | JJTBXHJPNHWABK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|