C14H11FN2O5 — CID 90687936
2-(3-fluoro-6-hydroxy-2,5-dioxopiperidin-3-yl)-4-methylisoindole-1,3-dione (PubChem CID 90687936) has the molecular formula C14H11FN2O5 and a molecular weight of 306.25 g/mol. Its IUPAC name is 2-(3-fluoro-6-hydroxy-2,5-dioxopiperidin-3-yl)-4-methylisoindole-1,3-dione.
| Compound Name | 2-(3-fluoro-6-hydroxy-2,5-dioxopiperidin-3-yl)-4-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 90687936 |
| Molecular Formula | C14H11FN2O5 |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-(3-fluoro-6-hydroxy-2,5-dioxopiperidin-3-yl)-4-methylisoindole-1,3-dione |
| SMILES | Cc1cccc2c1C(=O)N(C1(F)CC(=O)C(O)NC1=O)C2=O |
| InChI | InChI=1S/C14H11FN2O5/c1-6-3-2-4-7-9(6)12(21)17(11(7)20)14(15)5-8(18)10(19)16-13(14)22/h2-4,10,19H,5H2,1H3,(H,16,22) |
| InChIKey | KTNDIRJAJFZYLM-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|