C9H8NO4PS — CID 21445678
2-dihydroxyphosphinothioyl-4-methylisoindole-1,3-dione (PubChem CID 21445678) has the molecular formula C9H8NO4PS and a molecular weight of 257.21 g/mol. Its IUPAC name is 2-dihydroxyphosphinothioyl-4-methylisoindole-1,3-dione.
| Compound Name | 2-dihydroxyphosphinothioyl-4-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 21445678 |
| Molecular Formula | C9H8NO4PS |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 256.99 |
| IUPAC Name | 2-dihydroxyphosphinothioyl-4-methylisoindole-1,3-dione |
| SMILES | Cc1cccc2c1C(=O)N(P(O)(O)=S)C2=O |
| InChI | InChI=1S/C9H8NO4PS/c1-5-3-2-4-6-7(5)9(12)10(8(6)11)15(13,14)16/h2-4H,1H3,(H2,13,14,16) |
| InChIKey | IYUGQYZOIKTGOU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|