C16H16N4O5 — CID 11530279
2-amino-N-[2-(3-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide (PubChem CID 11530279) has the molecular formula C16H16N4O5 and a molecular weight of 344.33 g/mol. Its IUPAC name is 2-amino-N-[2-(3-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide.
| Compound Name | 2-amino-N-[2-(3-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 11530279 |
| Molecular Formula | C16H16N4O5 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-amino-N-[2-(3-methyl-2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]acetamide |
| SMILES | CC1(N2C(=O)c3cccc(NC(=O)CN)c3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C16H16N4O5/c1-16(6-5-10(21)19-15(16)25)20-13(23)8-3-2-4-9(12(8)14(20)24)18-11(22)7-17/h2-4H,5-7,17H2,1H3,(H,18,22)(H,19,21,25) |
| InChIKey | IXIKOANYTSMJSM-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|