C14H11N3O6 — CID 10805414
2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-4-nitroisoindole-1,3-dione (PubChem CID 10805414) has the molecular formula C14H11N3O6 and a molecular weight of 317.26 g/mol. Its IUPAC name is 2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 10805414 |
| Molecular Formula | C14H11N3O6 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 2-[(3S)-3-methyl-2,6-dioxopiperidin-3-yl]-4-nitroisoindole-1,3-dione |
| SMILES | C[C@]1(N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C14H11N3O6/c1-14(6-5-9(18)15-13(14)21)16-11(19)7-3-2-4-8(17(22)23)10(7)12(16)20/h2-4H,5-6H2,1H3,(H,15,18,21)/t14-/m0/s1 |
| InChIKey | SSFKURSGJRBEPO-AWEZNQCLSA-N |
| XLogP | 0.39 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|