C15H13N3O5 — CID 58708265
2-[(3R)-3-methyl-6-methylidene-2-oxopiperidin-3-yl]-4-nitroisoindole-1,3-dione (PubChem CID 58708265) has the molecular formula C15H13N3O5 and a molecular weight of 315.29 g/mol. Its IUPAC name is 2-[(3R)-3-methyl-6-methylidene-2-oxopiperidin-3-yl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[(3R)-3-methyl-6-methylidene-2-oxopiperidin-3-yl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 58708265 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2-[(3R)-3-methyl-6-methylidene-2-oxopiperidin-3-yl]-4-nitroisoindole-1,3-dione |
| SMILES | C=C1CC[C@@](C)(N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C15H13N3O5/c1-8-6-7-15(2,14(21)16-8)17-12(19)9-4-3-5-10(18(22)23)11(9)13(17)20/h3-5H,1,6-7H2,2H3,(H,16,21)/t15-/m1/s1 |
| InChIKey | KABPKZLFMQIQRH-OAHLLOKOSA-N |
| XLogP | 1.37 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|