C20H17N3O7 — CID 46242617
2-[2-(2,3-dimethoxyphenyl)-3-methyl-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione (PubChem CID 46242617) has the molecular formula C20H17N3O7 and a molecular weight of 411.37 g/mol. Its IUPAC name is 2-[2-(2,3-dimethoxyphenyl)-3-methyl-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-(2,3-dimethoxyphenyl)-3-methyl-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 46242617 |
| Molecular Formula | C20H17N3O7 |
| Molecular Weight | 411.37 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | 2-[2-(2,3-dimethoxyphenyl)-3-methyl-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione |
| SMILES | COc1cccc(C2NC(=O)C2(C)N2C(=O)c3cccc([N+](=O)[O-])c3C2=O)c1OC |
| InChI | InChI=1S/C20H17N3O7/c1-20(16(21-19(20)26)11-7-5-9-13(29-2)15(11)30-3)22-17(24)10-6-4-8-12(23(27)28)14(10)18(22)25/h4-9,16H,1-3H3,(H,21,26) |
| InChIKey | LBMMDGYQSJJYNR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|