C27H22BrN3O8 — CID 94850068
2-[(3S,4S)-1-(4-bromo-3-methylphenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)azetidin-3-yl]-4-nitroisoindole-1,3-dione (PubChem CID 94850068) has the molecular formula C27H22BrN3O8 and a molecular weight of 596.39 g/mol. Its IUPAC name is 2-[(3S,4S)-1-(4-bromo-3-methylphenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)azetidin-3-yl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[(3S,4S)-1-(4-bromo-3-methylphenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)azetidin-3-yl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 94850068 |
| Molecular Formula | C27H22BrN3O8 |
| Molecular Weight | 596.39 g/mol |
| Exact Mass | 595.06 |
| IUPAC Name | 2-[(3S,4S)-1-(4-bromo-3-methylphenyl)-2-oxo-4-(3,4,5-trimethoxyphenyl)azetidin-3-yl]-4-nitroisoindole-1,3-dione |
| SMILES | COc1cc([C@H]2[C@H](N3C(=O)c4cccc([N+](=O)[O-])c4C3=O)C(=O)N2c2ccc(Br)c(C)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H22BrN3O8/c1-13-10-15(8-9-17(13)28)29-22(14-11-19(37-2)24(39-4)20(12-14)38-3)23(27(29)34)30-25(32)16-6-5-7-18(31(35)36)21(16)26(30)33/h5-12,22-23H,1-4H3/t22-,23-/m0/s1 |
| InChIKey | UPJNOOQLHFHVHE-GOTSBHOMSA-N |
| XLogP | 4.44 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|