C26H20BrN3O6 — CID 94850225
2-[(2R,3S)-1-(4-bromo-3-methylphenyl)-2-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione (PubChem CID 94850225) has the molecular formula C26H20BrN3O6 and a molecular weight of 550.37 g/mol. Its IUPAC name is 2-[(2R,3S)-1-(4-bromo-3-methylphenyl)-2-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[(2R,3S)-1-(4-bromo-3-methylphenyl)-2-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 94850225 |
| Molecular Formula | C26H20BrN3O6 |
| Molecular Weight | 550.37 g/mol |
| Exact Mass | 549.05 |
| IUPAC Name | 2-[(2R,3S)-1-(4-bromo-3-methylphenyl)-2-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]-4-nitroisoindole-1,3-dione |
| SMILES | CCOc1ccc([C@@H]2[C@H](N3C(=O)c4cccc([N+](=O)[O-])c4C3=O)C(=O)N2c2ccc(Br)c(C)c2)cc1 |
| InChI | InChI=1S/C26H20BrN3O6/c1-3-36-17-10-7-15(8-11-17)22-23(26(33)28(22)16-9-12-19(27)14(2)13-16)29-24(31)18-5-4-6-20(30(34)35)21(18)25(29)32/h4-13,22-23H,3H2,1-2H3/t22-,23+/m1/s1 |
| InChIKey | XQGVZTABMCJFDE-PKTZIBPZSA-N |
| XLogP | 4.82 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|