C27H25N3O4 — CID 15992837
2-[2-[4-(dimethylamino)phenyl]-1-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione (PubChem CID 15992837) has the molecular formula C27H25N3O4 and a molecular weight of 455.51 g/mol. Its IUPAC name is 2-[2-[4-(dimethylamino)phenyl]-1-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(dimethylamino)phenyl]-1-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15992837 |
| Molecular Formula | C27H25N3O4 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 2-[2-[4-(dimethylamino)phenyl]-1-(4-ethoxyphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
| SMILES | CCOc1ccc(N2C(=O)C(N3C(=O)c4ccccc4C3=O)C2c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H25N3O4/c1-4-34-20-15-13-19(14-16-20)29-23(17-9-11-18(12-10-17)28(2)3)24(27(29)33)30-25(31)21-7-5-6-8-22(21)26(30)32/h5-16,23-24H,4H2,1-3H3 |
| InChIKey | GDVJOUKGMKAUQO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|