C26H17Cl4FN2O4 — CID 92907524
4,5,6,7-tetrachloro-2-[(2S,3R)-2-(4-ethoxyphenyl)-1-(3-fluoro-4-methylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione (PubChem CID 92907524) has the molecular formula C26H17Cl4FN2O4 and a molecular weight of 582.24 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[(2S,3R)-2-(4-ethoxyphenyl)-1-(3-fluoro-4-methylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[(2S,3R)-2-(4-ethoxyphenyl)-1-(3-fluoro-4-methylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 92907524 |
| Molecular Formula | C26H17Cl4FN2O4 |
| Molecular Weight | 582.24 g/mol |
| Exact Mass | 579.99 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[(2S,3R)-2-(4-ethoxyphenyl)-1-(3-fluoro-4-methylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
| SMILES | CCOc1ccc([C@H]2[C@@H](N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)C(=O)N2c2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C26H17Cl4FN2O4/c1-3-37-14-8-5-12(6-9-14)22-23(26(36)32(22)13-7-4-11(2)15(31)10-13)33-24(34)16-17(25(33)35)19(28)21(30)20(29)18(16)27/h4-10,22-23H,3H2,1-2H3/t22-,23+/m0/s1 |
| InChIKey | BUOWEROSIHYZMS-XZOQPEGZSA-N |
| XLogP | 6.90 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.24 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|