C25H14BrCl5N2O4 — CID 6617949
2-[2-(3-bromo-4-methoxyphenyl)-1-(3-chloro-4-methylphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione (PubChem CID 6617949) has the molecular formula C25H14BrCl5N2O4 and a molecular weight of 663.57 g/mol. Its IUPAC name is 2-[2-(3-bromo-4-methoxyphenyl)-1-(3-chloro-4-methylphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione.
| Compound Name | 2-[2-(3-bromo-4-methoxyphenyl)-1-(3-chloro-4-methylphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 6617949 |
| Molecular Formula | C25H14BrCl5N2O4 |
| Molecular Weight | 663.57 g/mol |
| Exact Mass | 659.86 |
| IUPAC Name | 2-[2-(3-bromo-4-methoxyphenyl)-1-(3-chloro-4-methylphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
| SMILES | COc1ccc(C2C(N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)C(=O)N2c2ccc(C)c(Cl)c2)cc1Br |
| InChI | InChI=1S/C25H14BrCl5N2O4/c1-9-3-5-11(8-13(9)27)32-21(10-4-6-14(37-2)12(26)7-10)22(25(32)36)33-23(34)15-16(24(33)35)18(29)20(31)19(30)17(15)28/h3-8,21-22H,1-2H3 |
| InChIKey | XUXCVWWDPWMIQI-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.57 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|