C25H14Cl6N2O5 — CID 99666705
4,5,6,7-tetrachloro-2-[(2S,3R)-1-(3,5-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione (PubChem CID 99666705) has the molecular formula C25H14Cl6N2O5 and a molecular weight of 635.11 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[(2S,3R)-1-(3,5-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[(2S,3R)-1-(3,5-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 99666705 |
| Molecular Formula | C25H14Cl6N2O5 |
| Molecular Weight | 635.11 g/mol |
| Exact Mass | 631.90 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[(2S,3R)-1-(3,5-dichlorophenyl)-2-(3,4-dimethoxyphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
| SMILES | COc1ccc([C@H]2[C@@H](N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)C(=O)N2c2cc(Cl)cc(Cl)c2)cc1OC |
| InChI | InChI=1S/C25H14Cl6N2O5/c1-37-13-4-3-9(5-14(13)38-2)21-22(25(36)32(21)12-7-10(26)6-11(27)8-12)33-23(34)15-16(24(33)35)18(29)20(31)19(30)17(15)28/h3-8,21-22H,1-2H3/t21-,22+/m0/s1 |
| InChIKey | WQMHETOZWHNHBF-FCHUYYIVSA-N |
| XLogP | 7.38 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.11 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|