C27H20Cl4N2O5 — CID 98122337
4,5,6,7-tetrachloro-2-[(2R,3S)-2-(3,4-dimethoxyphenyl)-1-(3,4-dimethylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione (PubChem CID 98122337) has the molecular formula C27H20Cl4N2O5 and a molecular weight of 594.28 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[(2R,3S)-2-(3,4-dimethoxyphenyl)-1-(3,4-dimethylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[(2R,3S)-2-(3,4-dimethoxyphenyl)-1-(3,4-dimethylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 98122337 |
| Molecular Formula | C27H20Cl4N2O5 |
| Molecular Weight | 594.28 g/mol |
| Exact Mass | 592.01 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[(2R,3S)-2-(3,4-dimethoxyphenyl)-1-(3,4-dimethylphenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
| SMILES | COc1ccc([C@@H]2[C@H](N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)C(=O)N2c2ccc(C)c(C)c2)cc1OC |
| InChI | InChI=1S/C27H20Cl4N2O5/c1-11-5-7-14(9-12(11)2)32-23(13-6-8-15(37-3)16(10-13)38-4)24(27(32)36)33-25(34)17-18(26(33)35)20(29)22(31)21(30)19(17)28/h5-10,23-24H,1-4H3/t23-,24+/m1/s1 |
| InChIKey | PHALNRGQERBOSS-RPWUZVMVSA-N |
| XLogP | 6.69 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.28 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|