C24H12BrCl5N2O3 — CID 92907598
2-[(2S,3S)-2-(3-bromophenyl)-1-(3-chloro-4-methylphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione (PubChem CID 92907598) has the molecular formula C24H12BrCl5N2O3 and a molecular weight of 633.54 g/mol. Its IUPAC name is 2-[(2S,3S)-2-(3-bromophenyl)-1-(3-chloro-4-methylphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione.
| Compound Name | 2-[(2S,3S)-2-(3-bromophenyl)-1-(3-chloro-4-methylphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 92907598 |
| Molecular Formula | C24H12BrCl5N2O3 |
| Molecular Weight | 633.54 g/mol |
| Exact Mass | 629.85 |
| IUPAC Name | 2-[(2S,3S)-2-(3-bromophenyl)-1-(3-chloro-4-methylphenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H](N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)[C@@H]2c2cccc(Br)c2)cc1Cl |
| InChI | InChI=1S/C24H12BrCl5N2O3/c1-9-5-6-12(8-13(9)26)31-20(10-3-2-4-11(25)7-10)21(24(31)35)32-22(33)14-15(23(32)34)17(28)19(30)18(29)16(14)27/h2-8,20-21H,1H3/t20-,21-/m0/s1 |
| InChIKey | OFCLAKDNFAJCDX-SFTDATJTSA-N |
| XLogP | 7.78 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.54 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|