C23H9Cl6FN2O3 — CID 98122332
4,5,6,7-tetrachloro-2-[(2S,3S)-1-(3,4-dichlorophenyl)-2-(3-fluorophenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione (PubChem CID 98122332) has the molecular formula C23H9Cl6FN2O3 and a molecular weight of 593.05 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[(2S,3S)-1-(3,4-dichlorophenyl)-2-(3-fluorophenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[(2S,3S)-1-(3,4-dichlorophenyl)-2-(3-fluorophenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 98122332 |
| Molecular Formula | C23H9Cl6FN2O3 |
| Molecular Weight | 593.05 g/mol |
| Exact Mass | 589.87 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[(2S,3S)-1-(3,4-dichlorophenyl)-2-(3-fluorophenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1[C@@H]1C(=O)N(c2ccc(Cl)c(Cl)c2)[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C23H9Cl6FN2O3/c24-11-5-4-10(7-12(11)25)31-19(8-2-1-3-9(30)6-8)20(23(31)35)32-21(33)13-14(22(32)34)16(27)18(29)17(28)15(13)26/h1-7,19-20H/t19-,20-/m0/s1 |
| InChIKey | BCNITSJOQAHEJF-PMACEKPBSA-N |
| XLogP | 7.50 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.05 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|