C22H11Cl4FN2O3S — CID 6617880
4,5,6,7-tetrachloro-2-[1-(3-fluoro-4-methylphenyl)-2-oxo-4-thiophen-2-ylazetidin-3-yl]isoindole-1,3-dione (PubChem CID 6617880) has the molecular formula C22H11Cl4FN2O3S and a molecular weight of 544.22 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[1-(3-fluoro-4-methylphenyl)-2-oxo-4-thiophen-2-ylazetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[1-(3-fluoro-4-methylphenyl)-2-oxo-4-thiophen-2-ylazetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6617880 |
| Molecular Formula | C22H11Cl4FN2O3S |
| Molecular Weight | 544.22 g/mol |
| Exact Mass | 541.92 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[1-(3-fluoro-4-methylphenyl)-2-oxo-4-thiophen-2-ylazetidin-3-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc(N2C(=O)C(N3C(=O)c4c(Cl)c(Cl)c(Cl)c(Cl)c4C3=O)C2c2cccs2)cc1F |
| InChI | InChI=1S/C22H11Cl4FN2O3S/c1-8-4-5-9(7-10(8)27)28-18(11-3-2-6-33-11)19(22(28)32)29-20(30)12-13(21(29)31)15(24)17(26)16(25)14(12)23/h2-7,18-19H,1H3 |
| InChIKey | DWPGKWUSPZGYOE-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.22 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|