C23H10BrCl4FN2O3 — CID 92907583
2-[(2S,3S)-1-(4-bromophenyl)-2-(3-fluorophenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione (PubChem CID 92907583) has the molecular formula C23H10BrCl4FN2O3 and a molecular weight of 603.06 g/mol. Its IUPAC name is 2-[(2S,3S)-1-(4-bromophenyl)-2-(3-fluorophenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione.
| Compound Name | 2-[(2S,3S)-1-(4-bromophenyl)-2-(3-fluorophenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
|---|---|
| PubChem CID | 92907583 |
| Molecular Formula | C23H10BrCl4FN2O3 |
| Molecular Weight | 603.06 g/mol |
| Exact Mass | 599.86 |
| IUPAC Name | 2-[(2S,3S)-1-(4-bromophenyl)-2-(3-fluorophenyl)-4-oxoazetidin-3-yl]-4,5,6,7-tetrachloroisoindole-1,3-dione |
| SMILES | O=C1c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)N1[C@@H]1C(=O)N(c2ccc(Br)cc2)[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C23H10BrCl4FN2O3/c24-10-4-6-12(7-5-10)30-19(9-2-1-3-11(29)8-9)20(23(30)34)31-21(32)13-14(22(31)33)16(26)18(28)17(27)15(13)25/h1-8,19-20H/t19-,20-/m0/s1 |
| InChIKey | BABSFDQTNWYKKH-PMACEKPBSA-N |
| XLogP | 6.95 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.06 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|