C24H12Cl4F2N2O3 — CID 98122266
4,5,6,7-tetrachloro-2-[(2R,3S)-1-(5-fluoro-2-methylphenyl)-2-(4-fluorophenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione (PubChem CID 98122266) has the molecular formula C24H12Cl4F2N2O3 and a molecular weight of 556.18 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-2-[(2R,3S)-1-(5-fluoro-2-methylphenyl)-2-(4-fluorophenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrachloro-2-[(2R,3S)-1-(5-fluoro-2-methylphenyl)-2-(4-fluorophenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 98122266 |
| Molecular Formula | C24H12Cl4F2N2O3 |
| Molecular Weight | 556.18 g/mol |
| Exact Mass | 553.96 |
| IUPAC Name | 4,5,6,7-tetrachloro-2-[(2R,3S)-1-(5-fluoro-2-methylphenyl)-2-(4-fluorophenyl)-4-oxoazetidin-3-yl]isoindole-1,3-dione |
| SMILES | Cc1ccc(F)cc1N1C(=O)[C@@H](N2C(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C2=O)[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H12Cl4F2N2O3/c1-9-2-5-12(30)8-13(9)31-20(10-3-6-11(29)7-4-10)21(24(31)35)32-22(33)14-15(23(32)34)17(26)19(28)18(27)16(14)25/h2-8,20-21H,1H3/t20-,21+/m1/s1 |
| InChIKey | XOWYJFOFMTXQAA-RTWAWAEBSA-N |
| XLogP | 6.64 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.18 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|