C22H14BrN3O5S — CID 92847820
2-[(3S,4R)-1-(4-bromo-3-methylphenyl)-2-oxo-4-thiophen-2-ylazetidin-3-yl]-5-nitroisoindole-1,3-dione (PubChem CID 92847820) has the molecular formula C22H14BrN3O5S and a molecular weight of 512.34 g/mol. Its IUPAC name is 2-[(3S,4R)-1-(4-bromo-3-methylphenyl)-2-oxo-4-thiophen-2-ylazetidin-3-yl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[(3S,4R)-1-(4-bromo-3-methylphenyl)-2-oxo-4-thiophen-2-ylazetidin-3-yl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 92847820 |
| Molecular Formula | C22H14BrN3O5S |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 510.98 |
| IUPAC Name | 2-[(3S,4R)-1-(4-bromo-3-methylphenyl)-2-oxo-4-thiophen-2-ylazetidin-3-yl]-5-nitroisoindole-1,3-dione |
| SMILES | Cc1cc(N2C(=O)[C@@H](N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)[C@@H]2c2cccs2)ccc1Br |
| InChI | InChI=1S/C22H14BrN3O5S/c1-11-9-12(5-7-16(11)23)24-18(17-3-2-8-32-17)19(22(24)29)25-20(27)14-6-4-13(26(30)31)10-15(14)21(25)28/h2-10,18-19H,1H3/t18-,19-/m0/s1 |
| InChIKey | GCWNBXCJMFEZMA-OALUTQOASA-N |
| XLogP | 4.48 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|