C26H20FN3O7 — CID 92847849
2-[(2S,3R)-2-(2,5-dimethoxyphenyl)-1-(3-fluoro-4-methylphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione (PubChem CID 92847849) has the molecular formula C26H20FN3O7 and a molecular weight of 505.46 g/mol. Its IUPAC name is 2-[(2S,3R)-2-(2,5-dimethoxyphenyl)-1-(3-fluoro-4-methylphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[(2S,3R)-2-(2,5-dimethoxyphenyl)-1-(3-fluoro-4-methylphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 92847849 |
| Molecular Formula | C26H20FN3O7 |
| Molecular Weight | 505.46 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 2-[(2S,3R)-2-(2,5-dimethoxyphenyl)-1-(3-fluoro-4-methylphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione |
| SMILES | COc1ccc(OC)c([C@H]2[C@@H](N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)C(=O)N2c2ccc(C)c(F)c2)c1 |
| InChI | InChI=1S/C26H20FN3O7/c1-13-4-5-14(11-20(13)27)28-22(19-12-16(36-2)7-9-21(19)37-3)23(26(28)33)29-24(31)17-8-6-15(30(34)35)10-18(17)25(29)32/h4-12,22-23H,1-3H3/t22-,23+/m0/s1 |
| InChIKey | YRPWNPMRBSVHKS-XZOQPEGZSA-N |
| XLogP | 3.81 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|