C25H18ClN3O7 — CID 92847854
2-[(2R,3S)-1-(4-chlorophenyl)-2-(2,5-dimethoxyphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione (PubChem CID 92847854) has the molecular formula C25H18ClN3O7 and a molecular weight of 507.89 g/mol. Its IUPAC name is 2-[(2R,3S)-1-(4-chlorophenyl)-2-(2,5-dimethoxyphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[(2R,3S)-1-(4-chlorophenyl)-2-(2,5-dimethoxyphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 92847854 |
| Molecular Formula | C25H18ClN3O7 |
| Molecular Weight | 507.89 g/mol |
| Exact Mass | 507.08 |
| IUPAC Name | 2-[(2R,3S)-1-(4-chlorophenyl)-2-(2,5-dimethoxyphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione |
| SMILES | COc1ccc(OC)c([C@@H]2[C@H](N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)C(=O)N2c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C25H18ClN3O7/c1-35-16-8-10-20(36-2)19(12-16)21-22(25(32)27(21)14-5-3-13(26)4-6-14)28-23(30)17-9-7-15(29(33)34)11-18(17)24(28)31/h3-12,21-22H,1-2H3/t21-,22+/m1/s1 |
| InChIKey | XXXPWVQNAAKKDM-YADHBBJMSA-N |
| XLogP | 4.02 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.89 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|