C25H16ClN3O8 — CID 94850474
2-[(2R,3S)-2-(1,3-benzodioxol-5-yl)-1-(3-chloro-4-methoxyphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione (PubChem CID 94850474) has the molecular formula C25H16ClN3O8 and a molecular weight of 521.87 g/mol. Its IUPAC name is 2-[(2R,3S)-2-(1,3-benzodioxol-5-yl)-1-(3-chloro-4-methoxyphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione.
| Compound Name | 2-[(2R,3S)-2-(1,3-benzodioxol-5-yl)-1-(3-chloro-4-methoxyphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 94850474 |
| Molecular Formula | C25H16ClN3O8 |
| Molecular Weight | 521.87 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 2-[(2R,3S)-2-(1,3-benzodioxol-5-yl)-1-(3-chloro-4-methoxyphenyl)-4-oxoazetidin-3-yl]-5-nitroisoindole-1,3-dione |
| SMILES | COc1ccc(N2C(=O)[C@@H](N3C(=O)c4ccc([N+](=O)[O-])cc4C3=O)[C@H]2c2ccc3c(c2)OCO3)cc1Cl |
| InChI | InChI=1S/C25H16ClN3O8/c1-35-18-7-4-13(10-17(18)26)27-21(12-2-6-19-20(8-12)37-11-36-19)22(25(27)32)28-23(30)15-5-3-14(29(33)34)9-16(15)24(28)31/h2-10,21-22H,11H2,1H3/t21-,22+/m1/s1 |
| InChIKey | DLLLYFYQCCVRMJ-YADHBBJMSA-N |
| XLogP | 3.74 |
| TPSA | 128.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.87 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|