C13H13FN2O4S — CID 170115852
N-[2-[(1S)-1-fluoro-2-[(S)-methylsulfinyl]ethyl]-1,3-dioxoisoindol-4-yl]acetamide (PubChem CID 170115852) has the molecular formula C13H13FN2O4S and a molecular weight of 312.32 g/mol. Its IUPAC name is N-[2-[(1S)-1-fluoro-2-[(S)-methylsulfinyl]ethyl]-1,3-dioxoisoindol-4-yl]acetamide.
| Compound Name | N-[2-[(1S)-1-fluoro-2-[(S)-methylsulfinyl]ethyl]-1,3-dioxoisoindol-4-yl]acetamide |
|---|---|
| PubChem CID | 170115852 |
| Molecular Formula | C13H13FN2O4S |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | N-[2-[(1S)-1-fluoro-2-[(S)-methylsulfinyl]ethyl]-1,3-dioxoisoindol-4-yl]acetamide |
| SMILES | CC(=O)Nc1cccc2c1C(=O)N([C@@H](F)C[S@](C)=O)C2=O |
| InChI | InChI=1S/C13H13FN2O4S/c1-7(17)15-9-5-3-4-8-11(9)13(19)16(12(8)18)10(14)6-21(2)20/h3-5,10H,6H2,1-2H3,(H,15,17)/t10-,21+/m1/s1 |
| InChIKey | HYKLCRXOLNECQE-UZJPJQLHSA-N |
| XLogP | 0.92 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|