C21H22N2O7S — CID 71464990
N-[2-[1-[3,4-bis(trideuteriomethoxy)phenyl]-1,2,2-trideuterio-2-(trideuteriomethylsulfonyl)ethyl]-1,3-dioxoisoindol-4-yl]-2,2,2-trideuterioacetamide (PubChem CID 71464990) has the molecular formula C21H22N2O7S and a molecular weight of 461.57 g/mol. Its IUPAC name is N-[2-[1-[3,4-bis(trideuteriomethoxy)phenyl]-1,2,2-trideuterio-2-(trideuteriomethylsulfonyl)ethyl]-1,3-dioxoisoindol-4-yl]-2,2,2-trideuterioacetamide.
| Compound Name | N-[2-[1-[3,4-bis(trideuteriomethoxy)phenyl]-1,2,2-trideuterio-2-(trideuteriomethylsulfonyl)ethyl]-1,3-dioxoisoindol-4-yl]-2,2,2-trideuterioacetamide |
|---|---|
| PubChem CID | 71464990 |
| Molecular Formula | C21H22N2O7S |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[2-[1-[3,4-bis(trideuteriomethoxy)phenyl]-1,2,2-trideuterio-2-(trideuteriomethylsulfonyl)ethyl]-1,3-dioxoisoindol-4-yl]-2,2,2-trideuterioacetamide |
| SMILES | [2H]C([2H])([2H])Oc1ccc(C([2H])(N2C(=O)c3cccc(NC(=O)C([2H])([2H])[2H])c3C2=O)C([2H])([2H])S(=O)(=O)C([2H])([2H])[2H])cc1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C21H22N2O7S/c1-12(24)22-15-7-5-6-14-19(15)21(26)23(20(14)25)16(11-31(4,27)28)13-8-9-17(29-2)18(10-13)30-3/h5-10,16H,11H2,1-4H3,(H,22,24)/i1D3,2D3,3D3,4D3,11D2,16D |
| InChIKey | FDOVYMAQRFWREY-PUTARGJWSA-N |
| XLogP | 2.04 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|