C24H23F2N3O6 — CID 124563407
(3S)-3-(4-acetamido-1,3-dioxoisoindol-2-yl)-3-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]propanamide (PubChem CID 124563407) has the molecular formula C24H23F2N3O6 and a molecular weight of 487.46 g/mol. Its IUPAC name is (3S)-3-(4-acetamido-1,3-dioxoisoindol-2-yl)-3-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]propanamide.
| Compound Name | (3S)-3-(4-acetamido-1,3-dioxoisoindol-2-yl)-3-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 124563407 |
| Molecular Formula | C24H23F2N3O6 |
| Molecular Weight | 487.46 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (3S)-3-(4-acetamido-1,3-dioxoisoindol-2-yl)-3-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]propanamide |
| SMILES | CC(=O)Nc1cccc2c1C(=O)N([C@@H](CC(N)=O)c1ccc(OC(F)F)c(OCC3CC3)c1)C2=O |
| InChI | InChI=1S/C24H23F2N3O6/c1-12(30)28-16-4-2-3-15-21(16)23(33)29(22(15)32)17(10-20(27)31)14-7-8-18(35-24(25)26)19(9-14)34-11-13-5-6-13/h2-4,7-9,13,17,24H,5-6,10-11H2,1H3,(H2,27,31)(H,28,30)/t17-/m0/s1 |
| InChIKey | PNMNETUNJABIGE-KRWDZBQOSA-N |
| XLogP | 3.25 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|