C22H19N3O6 — CID 58572152
benzyl N-[[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl]methyl]carbamate (PubChem CID 58572152) has the molecular formula C22H19N3O6 and a molecular weight of 421.41 g/mol. Its IUPAC name is benzyl N-[[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl]methyl]carbamate.
| Compound Name | benzyl N-[[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 58572152 |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | benzyl N-[[3-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl]methyl]carbamate |
| SMILES | O=C1CCC(CNC(=O)OCc2ccccc2)(N2C(=O)c3ccccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H19N3O6/c26-17-10-11-22(20(29)24-17,13-23-21(30)31-12-14-6-2-1-3-7-14)25-18(27)15-8-4-5-9-16(15)19(25)28/h1-9H,10-13H2,(H,23,30)(H,24,26,29) |
| InChIKey | GGOMDTRWDJVGGY-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|