C21H21N3O4 — CID 58572171
benzyl N-[[3-(benzylideneamino)-2,6-dioxopiperidin-3-yl]methyl]carbamate (PubChem CID 58572171) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is benzyl N-[[3-(benzylideneamino)-2,6-dioxopiperidin-3-yl]methyl]carbamate.
| Compound Name | benzyl N-[[3-(benzylideneamino)-2,6-dioxopiperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 58572171 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | benzyl N-[[3-(benzylideneamino)-2,6-dioxopiperidin-3-yl]methyl]carbamate |
| SMILES | O=C1CCC(CNC(=O)OCc2ccccc2)(/N=C/c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C21H21N3O4/c25-18-11-12-21(19(26)24-18,23-13-16-7-3-1-4-8-16)15-22-20(27)28-14-17-9-5-2-6-10-17/h1-10,13H,11-12,14-15H2,(H,22,27)(H,24,25,26)/b23-13+ |
| InChIKey | GLESILNOYVNEOH-YDZHTSKRSA-N |
| XLogP | 2.21 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|