C14H16N2O4 — CID 139248273
benzyl N-[(3R)-3-methyl-2,6-dioxopiperidin-3-yl]carbamate (PubChem CID 139248273) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is benzyl N-[(3R)-3-methyl-2,6-dioxopiperidin-3-yl]carbamate.
| Compound Name | benzyl N-[(3R)-3-methyl-2,6-dioxopiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 139248273 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | benzyl N-[(3R)-3-methyl-2,6-dioxopiperidin-3-yl]carbamate |
| SMILES | C[C@@]1(NC(=O)OCc2ccccc2)CCC(=O)NC1=O |
| InChI | InChI=1S/C14H16N2O4/c1-14(8-7-11(17)15-12(14)18)16-13(19)20-9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,16,19)(H,15,17,18)/t14-/m1/s1 |
| InChIKey | YCONTJVZSJAVSK-CQSZACIVSA-N |
| XLogP | 1.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|