C18H24N2O4 — CID 58525708
benzyl N-(3,4,4,5,5-pentamethyl-2,6-dioxopiperidin-3-yl)carbamate (PubChem CID 58525708) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is benzyl N-(3,4,4,5,5-pentamethyl-2,6-dioxopiperidin-3-yl)carbamate.
| Compound Name | benzyl N-(3,4,4,5,5-pentamethyl-2,6-dioxopiperidin-3-yl)carbamate |
|---|---|
| PubChem CID | 58525708 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | benzyl N-(3,4,4,5,5-pentamethyl-2,6-dioxopiperidin-3-yl)carbamate |
| SMILES | CC1(C)C(=O)NC(=O)C(C)(NC(=O)OCc2ccccc2)C1(C)C |
| InChI | InChI=1S/C18H24N2O4/c1-16(2)13(21)19-14(22)18(5,17(16,3)4)20-15(23)24-11-12-9-7-6-8-10-12/h6-10H,11H2,1-5H3,(H,20,23)(H,19,21,22) |
| InChIKey | GPHJJZSURSEPJC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|