About benzyl N-(methylamino)carbamate;hydrochloride
benzyl N-(methylamino)carbamate;hydrochloride (PubChem CID 24801390) has the molecular formula C9H13ClN2O2
and a molecular weight of 216.67 g/mol. Its IUPAC name is benzyl N-(methylamino)carbamate;hydrochloride.
Molecular Properties
| Compound Name | benzyl N-(methylamino)carbamate;hydrochloride |
| PubChem CID | 24801390 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | benzyl N-(methylamino)carbamate;hydrochloride |
| SMILES | CNNC(=O)OCc1ccccc1.Cl |
| InChI | InChI=1S/C9H12N2O2.ClH/c1-10-11-9(12)13-7-8-5-3-2-4-6-8;/h2-6,10H,7H2,1H3,(H,11,12);1H |
| InChIKey | KBENHDNRAGIFJV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-(methylamino)carbamate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-(methylamino)carbamate;hydrochloride?
The IUPAC name of benzyl N-(methylamino)carbamate;hydrochloride (CID 24801390) is benzyl N-(methylamino)carbamate;hydrochloride.
What is the SMILES notation for benzyl N-(methylamino)carbamate;hydrochloride?
The canonical SMILES for benzyl N-(methylamino)carbamate;hydrochloride is CNNC(=O)OCc1ccccc1.Cl.
What is the InChIKey of benzyl N-(methylamino)carbamate;hydrochloride?
The InChIKey is KBENHDNRAGIFJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2.ClH/c1-10-11-9(12)13-7-8-5-3-2-4-6-8;/h2-6,10H,7H2,1H3,(H,11,12);1H.
What are the key properties of benzyl N-(methylamino)carbamate;hydrochloride?
benzyl N-(methylamino)carbamate;hydrochloride has a molecular weight of 216.67 g/mol, XLogP of 1.47, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-(methylamino)carbamate;hydrochloride is sourced from PubChem (CID 24801390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).