About benzyl N-benzamidocarbamate
benzyl N-benzamidocarbamate (PubChem CID 4935848) has the molecular formula C15H14N2O3
and a molecular weight of 270.29 g/mol. Its IUPAC name is benzyl N-benzamidocarbamate.
Molecular Properties
| Compound Name | benzyl N-benzamidocarbamate |
| PubChem CID | 4935848 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | benzyl N-benzamidocarbamate |
| SMILES | O=C(NNC(=O)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C15H14N2O3/c18-14(13-9-5-2-6-10-13)16-17-15(19)20-11-12-7-3-1-4-8-12/h1-10H,11H2,(H,16,18)(H,17,19) |
| InChIKey | HLZPIGLRYFIVCO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-benzamidocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-benzamidocarbamate?
The IUPAC name of benzyl N-benzamidocarbamate (CID 4935848) is benzyl N-benzamidocarbamate.
What is the SMILES notation for benzyl N-benzamidocarbamate?
The canonical SMILES for benzyl N-benzamidocarbamate is O=C(NNC(=O)c1ccccc1)OCc1ccccc1.
What is the InChIKey of benzyl N-benzamidocarbamate?
The InChIKey is HLZPIGLRYFIVCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3/c18-14(13-9-5-2-6-10-13)16-17-15(19)20-11-12-7-3-1-4-8-12/h1-10H,11H2,(H,16,18)(H,17,19).
What are the key properties of benzyl N-benzamidocarbamate?
benzyl N-benzamidocarbamate has a molecular weight of 270.29 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-benzamidocarbamate is sourced from PubChem (CID 4935848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).