C24H25N3O4 — CID 6733878
(3-phenylmethoxyphenyl)methyl N-[[4-(dimethylamino)benzoyl]amino]carbamate (PubChem CID 6733878) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is (3-phenylmethoxyphenyl)methyl N-[[4-(dimethylamino)benzoyl]amino]carbamate.
| Compound Name | (3-phenylmethoxyphenyl)methyl N-[[4-(dimethylamino)benzoyl]amino]carbamate |
|---|---|
| PubChem CID | 6733878 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (3-phenylmethoxyphenyl)methyl N-[[4-(dimethylamino)benzoyl]amino]carbamate |
| SMILES | CN(C)c1ccc(C(=O)NNC(=O)OCc2cccc(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C24H25N3O4/c1-27(2)21-13-11-20(12-14-21)23(28)25-26-24(29)31-17-19-9-6-10-22(15-19)30-16-18-7-4-3-5-8-18/h3-15H,16-17H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | RXQUBJJYMVGYQZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|