C16H15NO4 — CID 27308455
benzyl N-[(1R)-1-hydroxy-2-oxo-2-phenylethyl]carbamate (PubChem CID 27308455) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is benzyl N-[(1R)-1-hydroxy-2-oxo-2-phenylethyl]carbamate.
| Compound Name | benzyl N-[(1R)-1-hydroxy-2-oxo-2-phenylethyl]carbamate |
|---|---|
| PubChem CID | 27308455 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | benzyl N-[(1R)-1-hydroxy-2-oxo-2-phenylethyl]carbamate |
| SMILES | O=C(N[C@H](O)C(=O)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C16H15NO4/c18-14(13-9-5-2-6-10-13)15(19)17-16(20)21-11-12-7-3-1-4-8-12/h1-10,15,19H,11H2,(H,17,20)/t15-/m1/s1 |
| InChIKey | UWEUBMRRBZVJCL-OAHLLOKOSA-N |
| XLogP | 2.11 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|