C19H21NO2 — CID 145156063
benzyl N-(1,6-dimethyl-2,3-dihydroinden-1-yl)carbamate (PubChem CID 145156063) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is benzyl N-(1,6-dimethyl-2,3-dihydroinden-1-yl)carbamate.
| Compound Name | benzyl N-(1,6-dimethyl-2,3-dihydroinden-1-yl)carbamate |
|---|---|
| PubChem CID | 145156063 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | benzyl N-(1,6-dimethyl-2,3-dihydroinden-1-yl)carbamate |
| SMILES | Cc1ccc2c(c1)C(C)(NC(=O)OCc1ccccc1)CC2 |
| InChI | InChI=1S/C19H21NO2/c1-14-8-9-16-10-11-19(2,17(16)12-14)20-18(21)22-13-15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3,(H,20,21) |
| InChIKey | GJHNPSRWFBCXCI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |