C20H16N2O5 — CID 166923724
2-(3-benzyl-2,6-dioxopiperidin-3-yl)-4-hydroxyisoindole-1,3-dione (PubChem CID 166923724) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 2-(3-benzyl-2,6-dioxopiperidin-3-yl)-4-hydroxyisoindole-1,3-dione.
| Compound Name | 2-(3-benzyl-2,6-dioxopiperidin-3-yl)-4-hydroxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 166923724 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-(3-benzyl-2,6-dioxopiperidin-3-yl)-4-hydroxyisoindole-1,3-dione |
| SMILES | O=C1CCC(Cc2ccccc2)(N2C(=O)c3cccc(O)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C20H16N2O5/c23-14-8-4-7-13-16(14)18(26)22(17(13)25)20(10-9-15(24)21-19(20)27)11-12-5-2-1-3-6-12/h1-8,23H,9-11H2,(H,21,24,27) |
| InChIKey | GAYIYBHGYFWYBF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|