C17H23ClN4O3 — CID 67997669
3-(4-aminobutyl)-3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;hydrochloride (PubChem CID 67997669) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is 3-(4-aminobutyl)-3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-(4-aminobutyl)-3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 67997669 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 3-(4-aminobutyl)-3-(7-amino-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione;hydrochloride |
| SMILES | Cl.NCCCCC1(N2Cc3c(N)cccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C17H22N4O3.ClH/c18-9-2-1-7-17(8-6-14(22)20-16(17)24)21-10-12-11(15(21)23)4-3-5-13(12)19;/h3-5H,1-2,6-10,18-19H2,(H,20,22,24);1H |
| InChIKey | KZDPHWYNUPYBHA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|