C24H35ClN4O3 — CID 170702131
3-[7-[[1-(4-aminobutyl)-4-methylcyclohexyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride (PubChem CID 170702131) has the molecular formula C24H35ClN4O3 and a molecular weight of 463.02 g/mol. Its IUPAC name is 3-[7-[[1-(4-aminobutyl)-4-methylcyclohexyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride.
| Compound Name | 3-[7-[[1-(4-aminobutyl)-4-methylcyclohexyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 170702131 |
| Molecular Formula | C24H35ClN4O3 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 3-[7-[[1-(4-aminobutyl)-4-methylcyclohexyl]amino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;hydrochloride |
| SMILES | CC1CCC(CCCCN)(Nc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)CC1.Cl |
| InChI | InChI=1S/C24H34N4O3.ClH/c1-16-9-12-24(13-10-16,11-2-3-14-25)27-19-6-4-5-17-18(19)15-28(23(17)31)20-7-8-21(29)26-22(20)30;/h4-6,16,20,27H,2-3,7-15,25H2,1H3,(H,26,29,30);1H |
| InChIKey | NHCAMITXYBURGZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|